About 2-prop-2-enyloctadecanal
2-prop-2-enyloctadecanal (PubChem CID 173235739) has the molecular formula C21H40O
and a molecular weight of 308.55 g/mol. Its IUPAC name is 2-prop-2-enyloctadecanal.
Molecular Properties
| Compound Name | 2-prop-2-enyloctadecanal |
| PubChem CID | 173235739 |
| Molecular Formula | C21H40O |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.31 |
| IUPAC Name | 2-prop-2-enyloctadecanal |
| SMILES | C=CCC(C=O)CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C21H40O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-21(20-22)18-4-2/h4,20-21H,2-3,5-19H2,1H3 |
| InChIKey | VYSDAIQCNAJXNL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enyloctadecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enyloctadecanal?
The IUPAC name of 2-prop-2-enyloctadecanal (CID 173235739) is 2-prop-2-enyloctadecanal.
What is the SMILES notation for 2-prop-2-enyloctadecanal?
The canonical SMILES for 2-prop-2-enyloctadecanal is C=CCC(C=O)CCCCCCCCCCCCCCCC.
What is the InChIKey of 2-prop-2-enyloctadecanal?
The InChIKey is VYSDAIQCNAJXNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-21(20-22)18-4-2/h4,20-21H,2-3,5-19H2,1H3.
What are the key properties of 2-prop-2-enyloctadecanal?
2-prop-2-enyloctadecanal has a molecular weight of 308.55 g/mol, XLogP of 7.25, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enyloctadecanal is sourced from PubChem (CID 173235739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).