About 10-ethenylnonadecane
10-ethenylnonadecane (PubChem CID 57244946) has the molecular formula C21H42
and a molecular weight of 294.57 g/mol. Its IUPAC name is 10-ethenylnonadecane.
Molecular Properties
| Compound Name | 10-ethenylnonadecane |
| PubChem CID | 57244946 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | 10-ethenylnonadecane |
| SMILES | C=CC(CCCCCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C21H42/c1-4-7-9-11-13-15-17-19-21(6-3)20-18-16-14-12-10-8-5-2/h6,21H,3-5,7-20H2,1-2H3 |
| InChIKey | IZVGAKUPGSWKIR-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-ethenylnonadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-ethenylnonadecane?
The IUPAC name of 10-ethenylnonadecane (CID 57244946) is 10-ethenylnonadecane.
What is the SMILES notation for 10-ethenylnonadecane?
The canonical SMILES for 10-ethenylnonadecane is C=CC(CCCCCCCCC)CCCCCCCCC.
What is the InChIKey of 10-ethenylnonadecane?
The InChIKey is IZVGAKUPGSWKIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42/c1-4-7-9-11-13-15-17-19-21(6-3)20-18-16-14-12-10-8-5-2/h6,21H,3-5,7-20H2,1-2H3.
What are the key properties of 10-ethenylnonadecane?
10-ethenylnonadecane has a molecular weight of 294.57 g/mol, XLogP of 8.07, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-ethenylnonadecane is sourced from PubChem (CID 57244946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).