About ethane;9-ethenylheptadecane;octane
ethane;9-ethenylheptadecane;octane (PubChem CID 168985515) has the molecular formula C29H62
and a molecular weight of 410.82 g/mol. Its IUPAC name is ethane;9-ethenylheptadecane;octane.
Molecular Properties
| Compound Name | ethane;9-ethenylheptadecane;octane |
| PubChem CID | 168985515 |
| Molecular Formula | C29H62 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.49 |
| IUPAC Name | ethane;9-ethenylheptadecane;octane |
| SMILES | C=CC(CCCCCCCC)CCCCCCCC.CC.CCCCCCCC |
| InChI | InChI=1S/C19H38.C8H18.C2H6/c1-4-7-9-11-13-15-17-19(6-3)18-16-14-12-10-8-5-2;1-3-5-7-8-6-4-2;1-2/h6,19H,3-5,7-18H2,1-2H3;3-8H2,1-2H3;1-2H3 |
| InChIKey | ZYIRYHLAVQMFTK-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;9-ethenylheptadecane;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-ethenylheptadecane;octane?
The IUPAC name of ethane;9-ethenylheptadecane;octane (CID 168985515) is ethane;9-ethenylheptadecane;octane.
What is the SMILES notation for ethane;9-ethenylheptadecane;octane?
The canonical SMILES for ethane;9-ethenylheptadecane;octane is C=CC(CCCCCCCC)CCCCCCCC.CC.CCCCCCCC.
What is the InChIKey of ethane;9-ethenylheptadecane;octane?
The InChIKey is ZYIRYHLAVQMFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38.C8H18.C2H6/c1-4-7-9-11-13-15-17-19(6-3)18-16-14-12-10-8-5-2;1-3-5-7-8-6-4-2;1-2/h6,19H,3-5,7-18H2,1-2H3;3-8H2,1-2H3;1-2H3.
What are the key properties of ethane;9-ethenylheptadecane;octane?
ethane;9-ethenylheptadecane;octane has a molecular weight of 410.82 g/mol, XLogP of 11.68, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-ethenylheptadecane;octane is sourced from PubChem (CID 168985515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).