About 4-ethenyldecane;octan-1-amine
4-ethenyldecane;octan-1-amine (PubChem CID 177360659) has the molecular formula C20H43N
and a molecular weight of 297.57 g/mol. Its IUPAC name is 4-ethenyldecane;octan-1-amine.
Molecular Properties
| Compound Name | 4-ethenyldecane;octan-1-amine |
| PubChem CID | 177360659 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | 4-ethenyldecane;octan-1-amine |
| SMILES | C=CC(CCC)CCCCCC.CCCCCCCCN |
| InChI | InChI=1S/C12H24.C8H19N/c1-4-7-8-9-11-12(6-3)10-5-2;1-2-3-4-5-6-7-8-9/h6,12H,3-5,7-11H2,1-2H3;2-9H2,1H3 |
| InChIKey | NORNQQGETPATNJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyldecane;octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyldecane;octan-1-amine?
The IUPAC name of 4-ethenyldecane;octan-1-amine (CID 177360659) is 4-ethenyldecane;octan-1-amine.
What is the SMILES notation for 4-ethenyldecane;octan-1-amine?
The canonical SMILES for 4-ethenyldecane;octan-1-amine is C=CC(CCC)CCCCCC.CCCCCCCCN.
What is the InChIKey of 4-ethenyldecane;octan-1-amine?
The InChIKey is NORNQQGETPATNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24.C8H19N/c1-4-7-8-9-11-12(6-3)10-5-2;1-2-3-4-5-6-7-8-9/h6,12H,3-5,7-11H2,1-2H3;2-9H2,1H3.
What are the key properties of 4-ethenyldecane;octan-1-amine?
4-ethenyldecane;octan-1-amine has a molecular weight of 297.57 g/mol, XLogP of 6.86, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyldecane;octan-1-amine is sourced from PubChem (CID 177360659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).