About (3R)-3-ethyloct-1-ene
(3R)-3-ethyloct-1-ene (PubChem CID 50898077) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is (3R)-3-ethyloct-1-ene.
Molecular Properties
| Compound Name | (3R)-3-ethyloct-1-ene |
| PubChem CID | 50898077 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | (3R)-3-ethyloct-1-ene |
| SMILES | C=C[C@H](CC)CCCCC |
| InChI | InChI=1S/C10H20/c1-4-7-8-9-10(5-2)6-3/h5,10H,2,4,6-9H2,1,3H3/t10-/m1/s1 |
| InChIKey | FVGYFLMOMXMNKY-SNVBAGLBSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-ethyloct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-ethyloct-1-ene?
The IUPAC name of (3R)-3-ethyloct-1-ene (CID 50898077) is (3R)-3-ethyloct-1-ene.
What is the SMILES notation for (3R)-3-ethyloct-1-ene?
The canonical SMILES for (3R)-3-ethyloct-1-ene is C=C[C@H](CC)CCCCC.
What is the InChIKey of (3R)-3-ethyloct-1-ene?
The InChIKey is FVGYFLMOMXMNKY-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H20/c1-4-7-8-9-10(5-2)6-3/h5,10H,2,4,6-9H2,1,3H3/t10-/m1/s1.
What are the key properties of (3R)-3-ethyloct-1-ene?
(3R)-3-ethyloct-1-ene has a molecular weight of 140.27 g/mol, XLogP of 3.78, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-ethyloct-1-ene is sourced from PubChem (CID 50898077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).