About 3-ethylnon-1-en-8-yne
3-ethylnon-1-en-8-yne (PubChem CID 123457209) has the molecular formula C11H18
and a molecular weight of 150.27 g/mol. Its IUPAC name is 3-ethylnon-1-en-8-yne.
Molecular Properties
| Compound Name | 3-ethylnon-1-en-8-yne |
| PubChem CID | 123457209 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 3-ethylnon-1-en-8-yne |
| SMILES | C#CCCCCC(C=C)CC |
| InChI | InChI=1S/C11H18/c1-4-7-8-9-10-11(5-2)6-3/h1,5,11H,2,6-10H2,3H3 |
| InChIKey | IYJGIBJEQSQHKP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylnon-1-en-8-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylnon-1-en-8-yne?
The IUPAC name of 3-ethylnon-1-en-8-yne (CID 123457209) is 3-ethylnon-1-en-8-yne.
What is the SMILES notation for 3-ethylnon-1-en-8-yne?
The canonical SMILES for 3-ethylnon-1-en-8-yne is C#CCCCCC(C=C)CC.
What is the InChIKey of 3-ethylnon-1-en-8-yne?
The InChIKey is IYJGIBJEQSQHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-4-7-8-9-10-11(5-2)6-3/h1,5,11H,2,6-10H2,3H3.
What are the key properties of 3-ethylnon-1-en-8-yne?
3-ethylnon-1-en-8-yne has a molecular weight of 150.27 g/mol, XLogP of 3.39, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylnon-1-en-8-yne is sourced from PubChem (CID 123457209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).