About 11-chlorohexadec-1-yne
11-chlorohexadec-1-yne (PubChem CID 171573932) has the molecular formula C16H29Cl
and a molecular weight of 256.86 g/mol. Its IUPAC name is 11-chlorohexadec-1-yne.
Molecular Properties
| Compound Name | 11-chlorohexadec-1-yne |
| PubChem CID | 171573932 |
| Molecular Formula | C16H29Cl |
| Molecular Weight | 256.86 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 11-chlorohexadec-1-yne |
| SMILES | C#CCCCCCCCCC(Cl)CCCCC |
| InChI | InChI=1S/C16H29Cl/c1-3-5-7-8-9-10-11-13-15-16(17)14-12-6-4-2/h1,16H,4-15H2,2H3 |
| InChIKey | KOBOFBXVZJDTMA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.86 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 11-chlorohexadec-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-chlorohexadec-1-yne?
The IUPAC name of 11-chlorohexadec-1-yne (CID 171573932) is 11-chlorohexadec-1-yne.
What is the SMILES notation for 11-chlorohexadec-1-yne?
The canonical SMILES for 11-chlorohexadec-1-yne is C#CCCCCCCCCC(Cl)CCCCC.
What is the InChIKey of 11-chlorohexadec-1-yne?
The InChIKey is KOBOFBXVZJDTMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29Cl/c1-3-5-7-8-9-10-11-13-15-16(17)14-12-6-4-2/h1,16H,4-15H2,2H3.
What are the key properties of 11-chlorohexadec-1-yne?
11-chlorohexadec-1-yne has a molecular weight of 256.86 g/mol, XLogP of 5.93, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-chlorohexadec-1-yne is sourced from PubChem (CID 171573932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).