About 4-chloropentadecane
4-chloropentadecane (PubChem CID 63459834) has the molecular formula C15H31Cl
and a molecular weight of 246.87 g/mol. Its IUPAC name is 4-chloropentadecane.
Molecular Properties
| Compound Name | 4-chloropentadecane |
| PubChem CID | 63459834 |
| Molecular Formula | C15H31Cl |
| Molecular Weight | 246.87 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 4-chloropentadecane |
| SMILES | CCCCCCCCCCCC(Cl)CCC |
| InChI | InChI=1S/C15H31Cl/c1-3-5-6-7-8-9-10-11-12-14-15(16)13-4-2/h15H,3-14H2,1-2H3 |
| InChIKey | VGXMBWXESODFAP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.87 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloropentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropentadecane?
The IUPAC name of 4-chloropentadecane (CID 63459834) is 4-chloropentadecane.
What is the SMILES notation for 4-chloropentadecane?
The canonical SMILES for 4-chloropentadecane is CCCCCCCCCCCC(Cl)CCC.
What is the InChIKey of 4-chloropentadecane?
The InChIKey is VGXMBWXESODFAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31Cl/c1-3-5-6-7-8-9-10-11-12-14-15(16)13-4-2/h15H,3-14H2,1-2H3.
What are the key properties of 4-chloropentadecane?
4-chloropentadecane has a molecular weight of 246.87 g/mol, XLogP of 6.31, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropentadecane is sourced from PubChem (CID 63459834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).