About (2S)-1,2-dichlorododecane
(2S)-1,2-dichlorododecane (PubChem CID 98052710) has the molecular formula C12H24Cl2
and a molecular weight of 239.23 g/mol. Its IUPAC name is (2S)-1,2-dichlorododecane.
Molecular Properties
| Compound Name | (2S)-1,2-dichlorododecane |
| PubChem CID | 98052710 |
| Molecular Formula | C12H24Cl2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (2S)-1,2-dichlorododecane |
| SMILES | CCCCCCCCCC[C@H](Cl)CCl |
| InChI | InChI=1S/C12H24Cl2/c1-2-3-4-5-6-7-8-9-10-12(14)11-13/h12H,2-11H2,1H3/t12-/m0/s1 |
| InChIKey | HMBLILXCOAXXCR-LBPRGKRZSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-dichlorododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-dichlorododecane?
The IUPAC name of (2S)-1,2-dichlorododecane (CID 98052710) is (2S)-1,2-dichlorododecane.
What is the SMILES notation for (2S)-1,2-dichlorododecane?
The canonical SMILES for (2S)-1,2-dichlorododecane is CCCCCCCCCC[C@H](Cl)CCl.
What is the InChIKey of (2S)-1,2-dichlorododecane?
The InChIKey is HMBLILXCOAXXCR-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H24Cl2/c1-2-3-4-5-6-7-8-9-10-12(14)11-13/h12H,2-11H2,1H3/t12-/m0/s1.
What are the key properties of (2S)-1,2-dichlorododecane?
(2S)-1,2-dichlorododecane has a molecular weight of 239.23 g/mol, XLogP of 5.36, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-dichlorododecane is sourced from PubChem (CID 98052710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).