About 4-chlorotridecane
4-chlorotridecane (PubChem CID 63460920) has the molecular formula C13H27Cl
and a molecular weight of 218.81 g/mol. Its IUPAC name is 4-chlorotridecane.
Molecular Properties
| Compound Name | 4-chlorotridecane |
| PubChem CID | 63460920 |
| Molecular Formula | C13H27Cl |
| Molecular Weight | 218.81 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-chlorotridecane |
| SMILES | CCCCCCCCCC(Cl)CCC |
| InChI | InChI=1S/C13H27Cl/c1-3-5-6-7-8-9-10-12-13(14)11-4-2/h13H,3-12H2,1-2H3 |
| InChIKey | ODWVBHLBRDQUOS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.81 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorotridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorotridecane?
The IUPAC name of 4-chlorotridecane (CID 63460920) is 4-chlorotridecane.
What is the SMILES notation for 4-chlorotridecane?
The canonical SMILES for 4-chlorotridecane is CCCCCCCCCC(Cl)CCC.
What is the InChIKey of 4-chlorotridecane?
The InChIKey is ODWVBHLBRDQUOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27Cl/c1-3-5-6-7-8-9-10-12-13(14)11-4-2/h13H,3-12H2,1-2H3.
What are the key properties of 4-chlorotridecane?
4-chlorotridecane has a molecular weight of 218.81 g/mol, XLogP of 5.53, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorotridecane is sourced from PubChem (CID 63460920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).