About 7-chloro-1-iodoundecane
7-chloro-1-iodoundecane (PubChem CID 122491544) has the molecular formula C11H22ClI
and a molecular weight of 316.65 g/mol. Its IUPAC name is 7-chloro-1-iodoundecane.
Molecular Properties
| Compound Name | 7-chloro-1-iodoundecane |
| PubChem CID | 122491544 |
| Molecular Formula | C11H22ClI |
| Molecular Weight | 316.65 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 7-chloro-1-iodoundecane |
| SMILES | CCCCC(Cl)CCCCCCI |
| InChI | InChI=1S/C11H22ClI/c1-2-3-8-11(12)9-6-4-5-7-10-13/h11H,2-10H2,1H3 |
| InChIKey | WZKYOWZJIXREJN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1-iodoundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-iodoundecane?
The IUPAC name of 7-chloro-1-iodoundecane (CID 122491544) is 7-chloro-1-iodoundecane.
What is the SMILES notation for 7-chloro-1-iodoundecane?
The canonical SMILES for 7-chloro-1-iodoundecane is CCCCC(Cl)CCCCCCI.
What is the InChIKey of 7-chloro-1-iodoundecane?
The InChIKey is WZKYOWZJIXREJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22ClI/c1-2-3-8-11(12)9-6-4-5-7-10-13/h11H,2-10H2,1H3.
What are the key properties of 7-chloro-1-iodoundecane?
7-chloro-1-iodoundecane has a molecular weight of 316.65 g/mol, XLogP of 5.17, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-iodoundecane is sourced from PubChem (CID 122491544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).