About 6-chloro-1-fluorodecane
6-chloro-1-fluorodecane (PubChem CID 175363910) has the molecular formula C10H20ClF
and a molecular weight of 194.72 g/mol. Its IUPAC name is 6-chloro-1-fluorodecane.
Molecular Properties
| Compound Name | 6-chloro-1-fluorodecane |
| PubChem CID | 175363910 |
| Molecular Formula | C10H20ClF |
| Molecular Weight | 194.72 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 6-chloro-1-fluorodecane |
| SMILES | CCCCC(Cl)CCCCCF |
| InChI | InChI=1S/C10H20ClF/c1-2-3-7-10(11)8-5-4-6-9-12/h10H,2-9H2,1H3 |
| InChIKey | CXVLPZUMVDCODW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1-fluorodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-fluorodecane?
The IUPAC name of 6-chloro-1-fluorodecane (CID 175363910) is 6-chloro-1-fluorodecane.
What is the SMILES notation for 6-chloro-1-fluorodecane?
The canonical SMILES for 6-chloro-1-fluorodecane is CCCCC(Cl)CCCCCF.
What is the InChIKey of 6-chloro-1-fluorodecane?
The InChIKey is CXVLPZUMVDCODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClF/c1-2-3-7-10(11)8-5-4-6-9-12/h10H,2-9H2,1H3.
What are the key properties of 6-chloro-1-fluorodecane?
6-chloro-1-fluorodecane has a molecular weight of 194.72 g/mol, XLogP of 4.31, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-fluorodecane is sourced from PubChem (CID 175363910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).