About 1,5-dichlorononane
1,5-dichlorononane (PubChem CID 57182000) has the molecular formula C9H18Cl2
and a molecular weight of 197.15 g/mol. Its IUPAC name is 1,5-dichlorononane.
Molecular Properties
| Compound Name | 1,5-dichlorononane |
| PubChem CID | 57182000 |
| Molecular Formula | C9H18Cl2 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1,5-dichlorononane |
| SMILES | CCCCC(Cl)CCCCCl |
| InChI | InChI=1S/C9H18Cl2/c1-2-3-6-9(11)7-4-5-8-10/h9H,2-8H2,1H3 |
| InChIKey | RTPJGHJQWPVIGC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dichlorononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichlorononane?
The IUPAC name of 1,5-dichlorononane (CID 57182000) is 1,5-dichlorononane.
What is the SMILES notation for 1,5-dichlorononane?
The canonical SMILES for 1,5-dichlorononane is CCCCC(Cl)CCCCCl.
What is the InChIKey of 1,5-dichlorononane?
The InChIKey is RTPJGHJQWPVIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18Cl2/c1-2-3-6-9(11)7-4-5-8-10/h9H,2-8H2,1H3.
What are the key properties of 1,5-dichlorononane?
1,5-dichlorononane has a molecular weight of 197.15 g/mol, XLogP of 4.19, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichlorononane is sourced from PubChem (CID 57182000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).