About 5-chlorononane;phosphoric acid
5-chlorononane;phosphoric acid (PubChem CID 88768187) has the molecular formula C9H22ClO4P
and a molecular weight of 260.70 g/mol. Its IUPAC name is 5-chlorononane;phosphoric acid.
Molecular Properties
| Compound Name | 5-chlorononane;phosphoric acid |
| PubChem CID | 88768187 |
| Molecular Formula | C9H22ClO4P |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-chlorononane;phosphoric acid |
| SMILES | CCCCC(Cl)CCCC.O=P(O)(O)O |
| InChI | InChI=1S/C9H19Cl.H3O4P/c1-3-5-7-9(10)8-6-4-2;1-5(2,3)4/h9H,3-8H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | PUEWWEIZDKGNOU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-chlorononane;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chlorononane;phosphoric acid?
The IUPAC name of 5-chlorononane;phosphoric acid (CID 88768187) is 5-chlorononane;phosphoric acid.
What is the SMILES notation for 5-chlorononane;phosphoric acid?
The canonical SMILES for 5-chlorononane;phosphoric acid is CCCCC(Cl)CCCC.O=P(O)(O)O.
What is the InChIKey of 5-chlorononane;phosphoric acid?
The InChIKey is PUEWWEIZDKGNOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19Cl.H3O4P/c1-3-5-7-9(10)8-6-4-2;1-5(2,3)4/h9H,3-8H2,1-2H3;(H3,1,2,3,4).
What are the key properties of 5-chlorononane;phosphoric acid?
5-chlorononane;phosphoric acid has a molecular weight of 260.70 g/mol, XLogP of 3.05, 6 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorononane;phosphoric acid is sourced from PubChem (CID 88768187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).