About 3-chloroheptanamide
3-chloroheptanamide (PubChem CID 174735984) has the molecular formula C7H14ClNO
and a molecular weight of 163.65 g/mol. Its IUPAC name is 3-chloroheptanamide.
Molecular Properties
| Compound Name | 3-chloroheptanamide |
| PubChem CID | 174735984 |
| Molecular Formula | C7H14ClNO |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 3-chloroheptanamide |
| SMILES | CCCCC(Cl)CC(N)=O |
| InChI | InChI=1S/C7H14ClNO/c1-2-3-4-6(8)5-7(9)10/h6H,2-5H2,1H3,(H2,9,10) |
| InChIKey | QFUHUMSKDBCYMI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroheptanamide?
The IUPAC name of 3-chloroheptanamide (CID 174735984) is 3-chloroheptanamide.
What is the SMILES notation for 3-chloroheptanamide?
The canonical SMILES for 3-chloroheptanamide is CCCCC(Cl)CC(N)=O.
What is the InChIKey of 3-chloroheptanamide?
The InChIKey is QFUHUMSKDBCYMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO/c1-2-3-4-6(8)5-7(9)10/h6H,2-5H2,1H3,(H2,9,10).
What are the key properties of 3-chloroheptanamide?
3-chloroheptanamide has a molecular weight of 163.65 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroheptanamide is sourced from PubChem (CID 174735984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).