C12H20Cl2O2 — CID 140986134
5,8-dichlorododecane-6,7-dione (PubChem CID 140986134) has the molecular formula C12H20Cl2O2 and a molecular weight of 267.20 g/mol. Its IUPAC name is 5,8-dichlorododecane-6,7-dione.
| Compound Name | 5,8-dichlorododecane-6,7-dione |
|---|---|
| PubChem CID | 140986134 |
| Molecular Formula | C12H20Cl2O2 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5,8-dichlorododecane-6,7-dione |
| SMILES | CCCCC(Cl)C(=O)C(=O)C(Cl)CCCC |
| InChI | InChI=1S/C12H20Cl2O2/c1-3-5-7-9(13)11(15)12(16)10(14)8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | KPLXRDMXOMQMQQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|