About 2-chlorooctadecanoyl chloride
2-chlorooctadecanoyl chloride (PubChem CID 20512617) has the molecular formula C18H34Cl2O
and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-chlorooctadecanoyl chloride.
Molecular Properties
| Compound Name | 2-chlorooctadecanoyl chloride |
| PubChem CID | 20512617 |
| Molecular Formula | C18H34Cl2O |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-chlorooctadecanoyl chloride |
| SMILES | CCCCCCCCCCCCCCCCC(Cl)C(=O)Cl |
| InChI | InChI=1S/C18H34Cl2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h17H,2-16H2,1H3 |
| InChIKey | VXCNYMHIDFXZKF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorooctadecanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorooctadecanoyl chloride?
The IUPAC name of 2-chlorooctadecanoyl chloride (CID 20512617) is 2-chlorooctadecanoyl chloride.
What is the SMILES notation for 2-chlorooctadecanoyl chloride?
The canonical SMILES for 2-chlorooctadecanoyl chloride is CCCCCCCCCCCCCCCCC(Cl)C(=O)Cl.
What is the InChIKey of 2-chlorooctadecanoyl chloride?
The InChIKey is VXCNYMHIDFXZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34Cl2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h17H,2-16H2,1H3.
What are the key properties of 2-chlorooctadecanoyl chloride?
2-chlorooctadecanoyl chloride has a molecular weight of 337.38 g/mol, XLogP of 7.23, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorooctadecanoyl chloride is sourced from PubChem (CID 20512617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).