About 2,4-dichlorononan-3-one
2,4-dichlorononan-3-one (PubChem CID 91753635) has the molecular formula C9H16Cl2O
and a molecular weight of 211.13 g/mol. Its IUPAC name is 2,4-dichlorononan-3-one.
Molecular Properties
| Compound Name | 2,4-dichlorononan-3-one |
| PubChem CID | 91753635 |
| Molecular Formula | C9H16Cl2O |
| Molecular Weight | 211.13 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2,4-dichlorononan-3-one |
| SMILES | CCCCCC(Cl)C(=O)C(C)Cl |
| InChI | InChI=1S/C9H16Cl2O/c1-3-4-5-6-8(11)9(12)7(2)10/h7-8H,3-6H2,1-2H3 |
| InChIKey | NYJAYMSCABMYSY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichlorononan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorononan-3-one?
The IUPAC name of 2,4-dichlorononan-3-one (CID 91753635) is 2,4-dichlorononan-3-one.
What is the SMILES notation for 2,4-dichlorononan-3-one?
The canonical SMILES for 2,4-dichlorononan-3-one is CCCCCC(Cl)C(=O)C(C)Cl.
What is the InChIKey of 2,4-dichlorononan-3-one?
The InChIKey is NYJAYMSCABMYSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16Cl2O/c1-3-4-5-6-8(11)9(12)7(2)10/h7-8H,3-6H2,1-2H3.
What are the key properties of 2,4-dichlorononan-3-one?
2,4-dichlorononan-3-one has a molecular weight of 211.13 g/mol, XLogP of 3.37, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorononan-3-one is sourced from PubChem (CID 91753635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).