About 9-chlorooctadecan-8-one
9-chlorooctadecan-8-one (PubChem CID 54543005) has the molecular formula C18H35ClO
and a molecular weight of 302.93 g/mol. Its IUPAC name is 9-chlorooctadecan-8-one.
Molecular Properties
| Compound Name | 9-chlorooctadecan-8-one |
| PubChem CID | 54543005 |
| Molecular Formula | C18H35ClO |
| Molecular Weight | 302.93 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 9-chlorooctadecan-8-one |
| SMILES | CCCCCCCCCC(Cl)C(=O)CCCCCCC |
| InChI | InChI=1S/C18H35ClO/c1-3-5-7-9-10-12-13-15-17(19)18(20)16-14-11-8-6-4-2/h17H,3-16H2,1-2H3 |
| InChIKey | ZEOLCANKDUKCDT-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.93 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-chlorooctadecan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chlorooctadecan-8-one?
The IUPAC name of 9-chlorooctadecan-8-one (CID 54543005) is 9-chlorooctadecan-8-one.
What is the SMILES notation for 9-chlorooctadecan-8-one?
The canonical SMILES for 9-chlorooctadecan-8-one is CCCCCCCCCC(Cl)C(=O)CCCCCCC.
What is the InChIKey of 9-chlorooctadecan-8-one?
The InChIKey is ZEOLCANKDUKCDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35ClO/c1-3-5-7-9-10-12-13-15-17(19)18(20)16-14-11-8-6-4-2/h17H,3-16H2,1-2H3.
What are the key properties of 9-chlorooctadecan-8-one?
9-chlorooctadecan-8-one has a molecular weight of 302.93 g/mol, XLogP of 6.66, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chlorooctadecan-8-one is sourced from PubChem (CID 54543005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).