About chloromethyl 2-chlorodecanoate
chloromethyl 2-chlorodecanoate (PubChem CID 543259) has the molecular formula C11H20Cl2O2
and a molecular weight of 255.18 g/mol. Its IUPAC name is chloromethyl 2-chlorodecanoate.
Molecular Properties
| Compound Name | chloromethyl 2-chlorodecanoate |
| PubChem CID | 543259 |
| Molecular Formula | C11H20Cl2O2 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | chloromethyl 2-chlorodecanoate |
| SMILES | CCCCCCCCC(Cl)C(=O)OCCl |
| InChI | InChI=1S/C11H20Cl2O2/c1-2-3-4-5-6-7-8-10(13)11(14)15-9-12/h10H,2-9H2,1H3 |
| InChIKey | ZBWKSSOXFUXWPK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 2-chlorodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 2-chlorodecanoate?
The IUPAC name of chloromethyl 2-chlorodecanoate (CID 543259) is chloromethyl 2-chlorodecanoate.
What is the SMILES notation for chloromethyl 2-chlorodecanoate?
The canonical SMILES for chloromethyl 2-chlorodecanoate is CCCCCCCCC(Cl)C(=O)OCCl.
What is the InChIKey of chloromethyl 2-chlorodecanoate?
The InChIKey is ZBWKSSOXFUXWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20Cl2O2/c1-2-3-4-5-6-7-8-10(13)11(14)15-9-12/h10H,2-9H2,1H3.
What are the key properties of chloromethyl 2-chlorodecanoate?
chloromethyl 2-chlorodecanoate has a molecular weight of 255.18 g/mol, XLogP of 4.08, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 2-chlorodecanoate is sourced from PubChem (CID 543259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).