C9H16Cl2O2 — CID 118275967
2,3-dichloronon-1-ene-1,1-diol (PubChem CID 118275967) has the molecular formula C9H16Cl2O2 and a molecular weight of 227.13 g/mol. Its IUPAC name is 2,3-dichloronon-1-ene-1,1-diol.
| Compound Name | 2,3-dichloronon-1-ene-1,1-diol |
|---|---|
| PubChem CID | 118275967 |
| Molecular Formula | C9H16Cl2O2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2,3-dichloronon-1-ene-1,1-diol |
| SMILES | CCCCCCC(Cl)C(Cl)=C(O)O |
| InChI | InChI=1S/C9H16Cl2O2/c1-2-3-4-5-6-7(10)8(11)9(12)13/h7,12-13H,2-6H2,1H3 |
| InChIKey | LTDMHQOVYJAOPD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|