About 6-iodododecane
6-iodododecane (PubChem CID 19090932) has the molecular formula C12H25I
and a molecular weight of 296.24 g/mol. Its IUPAC name is 6-iodododecane.
Molecular Properties
| Compound Name | 6-iodododecane |
| PubChem CID | 19090932 |
| Molecular Formula | C12H25I |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 6-iodododecane |
| SMILES | CCCCCCC(I)CCCCC |
| InChI | InChI=1S/C12H25I/c1-3-5-7-9-11-12(13)10-8-6-4-2/h12H,3-11H2,1-2H3 |
| InChIKey | XVUACXUMOLJAGB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodododecane?
The IUPAC name of 6-iodododecane (CID 19090932) is 6-iodododecane.
What is the SMILES notation for 6-iodododecane?
The canonical SMILES for 6-iodododecane is CCCCCCC(I)CCCCC.
What is the InChIKey of 6-iodododecane?
The InChIKey is XVUACXUMOLJAGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25I/c1-3-5-7-9-11-12(13)10-8-6-4-2/h12H,3-11H2,1-2H3.
What are the key properties of 6-iodododecane?
6-iodododecane has a molecular weight of 296.24 g/mol, XLogP of 5.34, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodododecane is sourced from PubChem (CID 19090932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).