About (4S)-4-iodooctane
(4S)-4-iodooctane (PubChem CID 97300695) has the molecular formula C8H17I
and a molecular weight of 240.13 g/mol. Its IUPAC name is (4S)-4-iodooctane.
Molecular Properties
| Compound Name | (4S)-4-iodooctane |
| PubChem CID | 97300695 |
| Molecular Formula | C8H17I |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | (4S)-4-iodooctane |
| SMILES | CCCC[C@@H](I)CCC |
| InChI | InChI=1S/C8H17I/c1-3-5-7-8(9)6-4-2/h8H,3-7H2,1-2H3/t8-/m0/s1 |
| InChIKey | RZONQKSTULVBKR-QMMMGPOBSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-iodooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-iodooctane?
The IUPAC name of (4S)-4-iodooctane (CID 97300695) is (4S)-4-iodooctane.
What is the SMILES notation for (4S)-4-iodooctane?
The canonical SMILES for (4S)-4-iodooctane is CCCC[C@@H](I)CCC.
What is the InChIKey of (4S)-4-iodooctane?
The InChIKey is RZONQKSTULVBKR-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H17I/c1-3-5-7-8(9)6-4-2/h8H,3-7H2,1-2H3/t8-/m0/s1.
What are the key properties of (4S)-4-iodooctane?
(4S)-4-iodooctane has a molecular weight of 240.13 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-iodooctane is sourced from PubChem (CID 97300695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).