About 4-iodo-8,12-dipropylhexadecane
4-iodo-8,12-dipropylhexadecane (PubChem CID 121245807) has the molecular formula C22H45I
and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-iodo-8,12-dipropylhexadecane.
Molecular Properties
| Compound Name | 4-iodo-8,12-dipropylhexadecane |
| PubChem CID | 121245807 |
| Molecular Formula | C22H45I |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 4-iodo-8,12-dipropylhexadecane |
| SMILES | CCCCC(CCC)CCCC(CCC)CCCC(I)CCC |
| InChI | InChI=1S/C22H45I/c1-5-9-15-20(12-6-2)16-10-17-21(13-7-3)18-11-19-22(23)14-8-4/h20-22H,5-19H2,1-4H3 |
| InChIKey | MRSSHACLEQPNBE-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-8,12-dipropylhexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-8,12-dipropylhexadecane?
The IUPAC name of 4-iodo-8,12-dipropylhexadecane (CID 121245807) is 4-iodo-8,12-dipropylhexadecane.
What is the SMILES notation for 4-iodo-8,12-dipropylhexadecane?
The canonical SMILES for 4-iodo-8,12-dipropylhexadecane is CCCCC(CCC)CCCC(CCC)CCCC(I)CCC.
What is the InChIKey of 4-iodo-8,12-dipropylhexadecane?
The InChIKey is MRSSHACLEQPNBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45I/c1-5-9-15-20(12-6-2)16-10-17-21(13-7-3)18-11-19-22(23)14-8-4/h20-22H,5-19H2,1-4H3.
What are the key properties of 4-iodo-8,12-dipropylhexadecane?
4-iodo-8,12-dipropylhexadecane has a molecular weight of 436.51 g/mol, XLogP of 8.95, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-8,12-dipropylhexadecane is sourced from PubChem (CID 121245807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).