About (2R)-1,2-diiodohexane
(2R)-1,2-diiodohexane (PubChem CID 118680674) has the molecular formula C6H12I2
and a molecular weight of 337.97 g/mol. Its IUPAC name is (2R)-1,2-diiodohexane.
Molecular Properties
| Compound Name | (2R)-1,2-diiodohexane |
| PubChem CID | 118680674 |
| Molecular Formula | C6H12I2 |
| Molecular Weight | 337.97 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | (2R)-1,2-diiodohexane |
| SMILES | CCCC[C@@H](I)CI |
| InChI | InChI=1S/C6H12I2/c1-2-3-4-6(8)5-7/h6H,2-5H2,1H3/t6-/m1/s1 |
| InChIKey | LEQRYJLODPPISB-ZCFIWIBFSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.97 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,2-diiodohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2-diiodohexane?
The IUPAC name of (2R)-1,2-diiodohexane (CID 118680674) is (2R)-1,2-diiodohexane.
What is the SMILES notation for (2R)-1,2-diiodohexane?
The canonical SMILES for (2R)-1,2-diiodohexane is CCCC[C@@H](I)CI.
What is the InChIKey of (2R)-1,2-diiodohexane?
The InChIKey is LEQRYJLODPPISB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H12I2/c1-2-3-4-6(8)5-7/h6H,2-5H2,1H3/t6-/m1/s1.
What are the key properties of (2R)-1,2-diiodohexane?
(2R)-1,2-diiodohexane has a molecular weight of 337.97 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2-diiodohexane is sourced from PubChem (CID 118680674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).