About 4-iodo-2-methyloctane
4-iodo-2-methyloctane (PubChem CID 174582268) has the molecular formula C9H19I
and a molecular weight of 254.15 g/mol. Its IUPAC name is 4-iodo-2-methyloctane.
Molecular Properties
| Compound Name | 4-iodo-2-methyloctane |
| PubChem CID | 174582268 |
| Molecular Formula | C9H19I |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 4-iodo-2-methyloctane |
| SMILES | CCCCC(I)CC(C)C |
| InChI | InChI=1S/C9H19I/c1-4-5-6-9(10)7-8(2)3/h8-9H,4-7H2,1-3H3 |
| InChIKey | QFRCZDCZFIHPIM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-2-methyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-2-methyloctane?
The IUPAC name of 4-iodo-2-methyloctane (CID 174582268) is 4-iodo-2-methyloctane.
What is the SMILES notation for 4-iodo-2-methyloctane?
The canonical SMILES for 4-iodo-2-methyloctane is CCCCC(I)CC(C)C.
What is the InChIKey of 4-iodo-2-methyloctane?
The InChIKey is QFRCZDCZFIHPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19I/c1-4-5-6-9(10)7-8(2)3/h8-9H,4-7H2,1-3H3.
What are the key properties of 4-iodo-2-methyloctane?
4-iodo-2-methyloctane has a molecular weight of 254.15 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-2-methyloctane is sourced from PubChem (CID 174582268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).