About 2,4-dimethyloctane;ethene
2,4-dimethyloctane;ethene (PubChem CID 156719555) has the molecular formula C12H26
and a molecular weight of 170.34 g/mol. Its IUPAC name is 2,4-dimethyloctane;ethene.
Molecular Properties
| Compound Name | 2,4-dimethyloctane;ethene |
| PubChem CID | 156719555 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | 2,4-dimethyloctane;ethene |
| SMILES | C=C.CCCCC(C)CC(C)C |
| InChI | InChI=1S/C10H22.C2H4/c1-5-6-7-10(4)8-9(2)3;1-2/h9-10H,5-8H2,1-4H3;1-2H2 |
| InChIKey | JORWTSWSDAAMLE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyloctane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyloctane;ethene?
The IUPAC name of 2,4-dimethyloctane;ethene (CID 156719555) is 2,4-dimethyloctane;ethene.
What is the SMILES notation for 2,4-dimethyloctane;ethene?
The canonical SMILES for 2,4-dimethyloctane;ethene is C=C.CCCCC(C)CC(C)C.
What is the InChIKey of 2,4-dimethyloctane;ethene?
The InChIKey is JORWTSWSDAAMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.C2H4/c1-5-6-7-10(4)8-9(2)3;1-2/h9-10H,5-8H2,1-4H3;1-2H2.
What are the key properties of 2,4-dimethyloctane;ethene?
2,4-dimethyloctane;ethene has a molecular weight of 170.34 g/mol, XLogP of 4.66, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyloctane;ethene is sourced from PubChem (CID 156719555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).