About 1,3-diiodononane
1,3-diiodononane (PubChem CID 168864693) has the molecular formula C9H18I2
and a molecular weight of 380.05 g/mol. Its IUPAC name is 1,3-diiodononane.
Molecular Properties
| Compound Name | 1,3-diiodononane |
| PubChem CID | 168864693 |
| Molecular Formula | C9H18I2 |
| Molecular Weight | 380.05 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 1,3-diiodononane |
| SMILES | CCCCCCC(I)CCI |
| InChI | InChI=1S/C9H18I2/c1-2-3-4-5-6-9(11)7-8-10/h9H,2-8H2,1H3 |
| InChIKey | NRBUAETYYOUGFR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.05 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diiodononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diiodononane?
The IUPAC name of 1,3-diiodononane (CID 168864693) is 1,3-diiodononane.
What is the SMILES notation for 1,3-diiodononane?
The canonical SMILES for 1,3-diiodononane is CCCCCCC(I)CCI.
What is the InChIKey of 1,3-diiodononane?
The InChIKey is NRBUAETYYOUGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18I2/c1-2-3-4-5-6-9(11)7-8-10/h9H,2-8H2,1H3.
What are the key properties of 1,3-diiodononane?
1,3-diiodononane has a molecular weight of 380.05 g/mol, XLogP of 4.59, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diiodononane is sourced from PubChem (CID 168864693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).