About 2-iodooctadecane
2-iodooctadecane (PubChem CID 138596673) has the molecular formula C18H37I
and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-iodooctadecane.
Molecular Properties
| Compound Name | 2-iodooctadecane |
| PubChem CID | 138596673 |
| Molecular Formula | C18H37I |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-iodooctadecane |
| SMILES | CCCCCCCCCCCCCCCCC(C)I |
| InChI | InChI=1S/C18H37I/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)19/h18H,3-17H2,1-2H3 |
| InChIKey | RFPLSGGRRCBHFQ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodooctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodooctadecane?
The IUPAC name of 2-iodooctadecane (CID 138596673) is 2-iodooctadecane.
What is the SMILES notation for 2-iodooctadecane?
The canonical SMILES for 2-iodooctadecane is CCCCCCCCCCCCCCCCC(C)I.
What is the InChIKey of 2-iodooctadecane?
The InChIKey is RFPLSGGRRCBHFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37I/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)19/h18H,3-17H2,1-2H3.
What are the key properties of 2-iodooctadecane?
2-iodooctadecane has a molecular weight of 380.40 g/mol, XLogP of 7.68, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodooctadecane is sourced from PubChem (CID 138596673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).