About 2,3-diiododecane
2,3-diiododecane (PubChem CID 14475432) has the molecular formula C10H20I2
and a molecular weight of 394.08 g/mol. Its IUPAC name is 2,3-diiododecane.
Molecular Properties
| Compound Name | 2,3-diiododecane |
| PubChem CID | 14475432 |
| Molecular Formula | C10H20I2 |
| Molecular Weight | 394.08 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 2,3-diiododecane |
| SMILES | CCCCCCCC(I)C(C)I |
| InChI | InChI=1S/C10H20I2/c1-3-4-5-6-7-8-10(12)9(2)11/h9-10H,3-8H2,1-2H3 |
| InChIKey | CYEZTVGTLVUAMP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.08 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diiododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diiododecane?
The IUPAC name of 2,3-diiododecane (CID 14475432) is 2,3-diiododecane.
What is the SMILES notation for 2,3-diiododecane?
The canonical SMILES for 2,3-diiododecane is CCCCCCCC(I)C(C)I.
What is the InChIKey of 2,3-diiododecane?
The InChIKey is CYEZTVGTLVUAMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20I2/c1-3-4-5-6-7-8-10(12)9(2)11/h9-10H,3-8H2,1-2H3.
What are the key properties of 2,3-diiododecane?
2,3-diiododecane has a molecular weight of 394.08 g/mol, XLogP of 4.97, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diiododecane is sourced from PubChem (CID 14475432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).