About (3R)-1-iododecan-3-ol
(3R)-1-iododecan-3-ol (PubChem CID 18651328) has the molecular formula C10H21IO
and a molecular weight of 284.18 g/mol. Its IUPAC name is (3R)-1-iododecan-3-ol.
Molecular Properties
| Compound Name | (3R)-1-iododecan-3-ol |
| PubChem CID | 18651328 |
| Molecular Formula | C10H21IO |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (3R)-1-iododecan-3-ol |
| SMILES | CCCCCCC[C@@H](O)CCI |
| InChI | InChI=1S/C10H21IO/c1-2-3-4-5-6-7-10(12)8-9-11/h10,12H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | VRVBEIKLDWZSBI-SNVBAGLBSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-iododecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-iododecan-3-ol?
The IUPAC name of (3R)-1-iododecan-3-ol (CID 18651328) is (3R)-1-iododecan-3-ol.
What is the SMILES notation for (3R)-1-iododecan-3-ol?
The canonical SMILES for (3R)-1-iododecan-3-ol is CCCCCCC[C@@H](O)CCI.
What is the InChIKey of (3R)-1-iododecan-3-ol?
The InChIKey is VRVBEIKLDWZSBI-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H21IO/c1-2-3-4-5-6-7-10(12)8-9-11/h10,12H,2-9H2,1H3/t10-/m1/s1.
What are the key properties of (3R)-1-iododecan-3-ol?
(3R)-1-iododecan-3-ol has a molecular weight of 284.18 g/mol, XLogP of 3.53, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-iododecan-3-ol is sourced from PubChem (CID 18651328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).