About 3-iodotetradecane
3-iodotetradecane (PubChem CID 122583608) has the molecular formula C14H29I
and a molecular weight of 324.29 g/mol. Its IUPAC name is 3-iodotetradecane.
Molecular Properties
| Compound Name | 3-iodotetradecane |
| PubChem CID | 122583608 |
| Molecular Formula | C14H29I |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-iodotetradecane |
| SMILES | CCCCCCCCCCCC(I)CC |
| InChI | InChI=1S/C14H29I/c1-3-5-6-7-8-9-10-11-12-13-14(15)4-2/h14H,3-13H2,1-2H3 |
| InChIKey | AISRGEZPLLWWQK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodotetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodotetradecane?
The IUPAC name of 3-iodotetradecane (CID 122583608) is 3-iodotetradecane.
What is the SMILES notation for 3-iodotetradecane?
The canonical SMILES for 3-iodotetradecane is CCCCCCCCCCCC(I)CC.
What is the InChIKey of 3-iodotetradecane?
The InChIKey is AISRGEZPLLWWQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29I/c1-3-5-6-7-8-9-10-11-12-13-14(15)4-2/h14H,3-13H2,1-2H3.
What are the key properties of 3-iodotetradecane?
3-iodotetradecane has a molecular weight of 324.29 g/mol, XLogP of 6.12, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodotetradecane is sourced from PubChem (CID 122583608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).