About 2-chlorohexanethioamide
2-chlorohexanethioamide (PubChem CID 174768510) has the molecular formula C6H12ClNS
and a molecular weight of 165.69 g/mol. Its IUPAC name is 2-chlorohexanethioamide.
Molecular Properties
| Compound Name | 2-chlorohexanethioamide |
| PubChem CID | 174768510 |
| Molecular Formula | C6H12ClNS |
| Molecular Weight | 165.69 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 2-chlorohexanethioamide |
| SMILES | CCCCC(Cl)C(N)=S |
| InChI | InChI=1S/C6H12ClNS/c1-2-3-4-5(7)6(8)9/h5H,2-4H2,1H3,(H2,8,9) |
| InChIKey | IHHQBVQJLBLHIP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.69 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorohexanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorohexanethioamide?
The IUPAC name of 2-chlorohexanethioamide (CID 174768510) is 2-chlorohexanethioamide.
What is the SMILES notation for 2-chlorohexanethioamide?
The canonical SMILES for 2-chlorohexanethioamide is CCCCC(Cl)C(N)=S.
What is the InChIKey of 2-chlorohexanethioamide?
The InChIKey is IHHQBVQJLBLHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNS/c1-2-3-4-5(7)6(8)9/h5H,2-4H2,1H3,(H2,8,9).
What are the key properties of 2-chlorohexanethioamide?
2-chlorohexanethioamide has a molecular weight of 165.69 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorohexanethioamide is sourced from PubChem (CID 174768510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).