About 2-ethylhexanethioamide
2-ethylhexanethioamide (PubChem CID 87934878) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is 2-ethylhexanethioamide.
Molecular Properties
| Compound Name | 2-ethylhexanethioamide |
| PubChem CID | 87934878 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 2-ethylhexanethioamide |
| SMILES | CCCCC(CC)C(N)=S |
| InChI | InChI=1S/C8H17NS/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | MBNCJLOUDYDTIF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanethioamide?
The IUPAC name of 2-ethylhexanethioamide (CID 87934878) is 2-ethylhexanethioamide.
What is the SMILES notation for 2-ethylhexanethioamide?
The canonical SMILES for 2-ethylhexanethioamide is CCCCC(CC)C(N)=S.
What is the InChIKey of 2-ethylhexanethioamide?
The InChIKey is MBNCJLOUDYDTIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10).
What are the key properties of 2-ethylhexanethioamide?
2-ethylhexanethioamide has a molecular weight of 159.30 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanethioamide is sourced from PubChem (CID 87934878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).