About carbamodithioic acid;3-methanidylheptane;zinc
carbamodithioic acid;3-methanidylheptane;zinc (PubChem CID 174796340) has the molecular formula C9H20NS2Zn-
and a molecular weight of 271.79 g/mol. Its IUPAC name is carbamodithioic acid;3-methanidylheptane;zinc.
Molecular Properties
| Compound Name | carbamodithioic acid;3-methanidylheptane;zinc |
| PubChem CID | 174796340 |
| Molecular Formula | C9H20NS2Zn- |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | carbamodithioic acid;3-methanidylheptane;zinc |
| SMILES | NC(=S)S.[CH2-]C(CC)CCCC.[Zn] |
| InChI | InChI=1S/C8H17.CH3NS2.Zn/c1-4-6-7-8(3)5-2;2-1(3)4;/h8H,3-7H2,1-2H3;(H3,2,3,4);/q-1;; |
| InChIKey | GLXBDDWTKASOML-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamodithioic acid;3-methanidylheptane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamodithioic acid;3-methanidylheptane;zinc?
The IUPAC name of carbamodithioic acid;3-methanidylheptane;zinc (CID 174796340) is carbamodithioic acid;3-methanidylheptane;zinc.
What is the SMILES notation for carbamodithioic acid;3-methanidylheptane;zinc?
The canonical SMILES for carbamodithioic acid;3-methanidylheptane;zinc is NC(=S)S.[CH2-]C(CC)CCCC.[Zn].
What is the InChIKey of carbamodithioic acid;3-methanidylheptane;zinc?
The InChIKey is GLXBDDWTKASOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.CH3NS2.Zn/c1-4-6-7-8(3)5-2;2-1(3)4;/h8H,3-7H2,1-2H3;(H3,2,3,4);/q-1;;.
What are the key properties of carbamodithioic acid;3-methanidylheptane;zinc?
carbamodithioic acid;3-methanidylheptane;zinc has a molecular weight of 271.79 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamodithioic acid;3-methanidylheptane;zinc is sourced from PubChem (CID 174796340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).