About 3-methanidylheptane;zinc;hydrobromide
3-methanidylheptane;zinc;hydrobromide (PubChem CID 90200578) has the molecular formula C8H18BrZn-
and a molecular weight of 259.53 g/mol. Its IUPAC name is 3-methanidylheptane;zinc;hydrobromide.
Molecular Properties
| Compound Name | 3-methanidylheptane;zinc;hydrobromide |
| PubChem CID | 90200578 |
| Molecular Formula | C8H18BrZn- |
| Molecular Weight | 259.53 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 3-methanidylheptane;zinc;hydrobromide |
| SMILES | Br.[CH2-]C(CC)CCCC.[Zn] |
| InChI | InChI=1S/C8H17.BrH.Zn/c1-4-6-7-8(3)5-2;;/h8H,3-7H2,1-2H3;1H;/q-1;; |
| InChIKey | RWVQADYXQDPZIN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methanidylheptane;zinc;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methanidylheptane;zinc;hydrobromide?
The IUPAC name of 3-methanidylheptane;zinc;hydrobromide (CID 90200578) is 3-methanidylheptane;zinc;hydrobromide.
What is the SMILES notation for 3-methanidylheptane;zinc;hydrobromide?
The canonical SMILES for 3-methanidylheptane;zinc;hydrobromide is Br.[CH2-]C(CC)CCCC.[Zn].
What is the InChIKey of 3-methanidylheptane;zinc;hydrobromide?
The InChIKey is RWVQADYXQDPZIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.BrH.Zn/c1-4-6-7-8(3)5-2;;/h8H,3-7H2,1-2H3;1H;/q-1;;.
What are the key properties of 3-methanidylheptane;zinc;hydrobromide?
3-methanidylheptane;zinc;hydrobromide has a molecular weight of 259.53 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methanidylheptane;zinc;hydrobromide is sourced from PubChem (CID 90200578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).