About 2-methylicosanethioamide
2-methylicosanethioamide (PubChem CID 23451986) has the molecular formula C21H43NS
and a molecular weight of 341.65 g/mol. Its IUPAC name is 2-methylicosanethioamide.
Molecular Properties
| Compound Name | 2-methylicosanethioamide |
| PubChem CID | 23451986 |
| Molecular Formula | C21H43NS |
| Molecular Weight | 341.65 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | 2-methylicosanethioamide |
| SMILES | CCCCCCCCCCCCCCCCCCC(C)C(N)=S |
| InChI | InChI=1S/C21H43NS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21(22)23/h20H,3-19H2,1-2H3,(H2,22,23) |
| InChIKey | CIZCVXQWYKRREZ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylicosanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylicosanethioamide?
The IUPAC name of 2-methylicosanethioamide (CID 23451986) is 2-methylicosanethioamide.
What is the SMILES notation for 2-methylicosanethioamide?
The canonical SMILES for 2-methylicosanethioamide is CCCCCCCCCCCCCCCCCCC(C)C(N)=S.
What is the InChIKey of 2-methylicosanethioamide?
The InChIKey is CIZCVXQWYKRREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21(22)23/h20H,3-19H2,1-2H3,(H2,22,23).
What are the key properties of 2-methylicosanethioamide?
2-methylicosanethioamide has a molecular weight of 341.65 g/mol, XLogP of 7.56, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylicosanethioamide is sourced from PubChem (CID 23451986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).