About 2-aminoheptanethioamide
2-aminoheptanethioamide (PubChem CID 54382864) has the molecular formula C7H16N2S
and a molecular weight of 160.29 g/mol. Its IUPAC name is 2-aminoheptanethioamide.
Molecular Properties
| Compound Name | 2-aminoheptanethioamide |
| PubChem CID | 54382864 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-aminoheptanethioamide |
| SMILES | CCCCCC(N)C(N)=S |
| InChI | InChI=1S/C7H16N2S/c1-2-3-4-5-6(8)7(9)10/h6H,2-5,8H2,1H3,(H2,9,10) |
| InChIKey | GYXKBHOIRVPUBO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoheptanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoheptanethioamide?
The IUPAC name of 2-aminoheptanethioamide (CID 54382864) is 2-aminoheptanethioamide.
What is the SMILES notation for 2-aminoheptanethioamide?
The canonical SMILES for 2-aminoheptanethioamide is CCCCCC(N)C(N)=S.
What is the InChIKey of 2-aminoheptanethioamide?
The InChIKey is GYXKBHOIRVPUBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2S/c1-2-3-4-5-6(8)7(9)10/h6H,2-5,8H2,1H3,(H2,9,10).
What are the key properties of 2-aminoheptanethioamide?
2-aminoheptanethioamide has a molecular weight of 160.29 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoheptanethioamide is sourced from PubChem (CID 54382864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).