About tetradecan-2-ylthiourea
tetradecan-2-ylthiourea (PubChem CID 21132755) has the molecular formula C15H32N2S
and a molecular weight of 272.50 g/mol. Its IUPAC name is tetradecan-2-ylthiourea.
Molecular Properties
| Compound Name | tetradecan-2-ylthiourea |
| PubChem CID | 21132755 |
| Molecular Formula | C15H32N2S |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | tetradecan-2-ylthiourea |
| SMILES | CCCCCCCCCCCCC(C)NC(N)=S |
| InChI | InChI=1S/C15H32N2S/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)17-15(16)18/h14H,3-13H2,1-2H3,(H3,16,17,18) |
| InChIKey | VSRDRDIIKJTPMW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tetradecan-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecan-2-ylthiourea?
The IUPAC name of tetradecan-2-ylthiourea (CID 21132755) is tetradecan-2-ylthiourea.
What is the SMILES notation for tetradecan-2-ylthiourea?
The canonical SMILES for tetradecan-2-ylthiourea is CCCCCCCCCCCCC(C)NC(N)=S.
What is the InChIKey of tetradecan-2-ylthiourea?
The InChIKey is VSRDRDIIKJTPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2S/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)17-15(16)18/h14H,3-13H2,1-2H3,(H3,16,17,18).
What are the key properties of tetradecan-2-ylthiourea?
tetradecan-2-ylthiourea has a molecular weight of 272.50 g/mol, XLogP of 4.52, 12 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecan-2-ylthiourea is sourced from PubChem (CID 21132755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).