C19H38N4S2 — CID 98132830
1-[(2S)-but-3-en-2-yl]-3-[[(2S)-tridecan-2-yl]carbamothioylamino]thiourea (PubChem CID 98132830) has the molecular formula C19H38N4S2 and a molecular weight of 386.68 g/mol. Its IUPAC name is 1-[(2S)-but-3-en-2-yl]-3-[[(2S)-tridecan-2-yl]carbamothioylamino]thiourea.
| Compound Name | 1-[(2S)-but-3-en-2-yl]-3-[[(2S)-tridecan-2-yl]carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 98132830 |
| Molecular Formula | C19H38N4S2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 1-[(2S)-but-3-en-2-yl]-3-[[(2S)-tridecan-2-yl]carbamothioylamino]thiourea |
| SMILES | C=C[C@H](C)NC(=S)NNC(=S)N[C@@H](C)CCCCCCCCCCC |
| InChI | InChI=1S/C19H38N4S2/c1-5-7-8-9-10-11-12-13-14-15-17(4)21-19(25)23-22-18(24)20-16(3)6-2/h6,16-17H,2,5,7-15H2,1,3-4H3,(H2,20,22,24)(H2,21,23,25)/t16-,17-/m0/s1 |
| InChIKey | NFSOZSPQTXNEJG-IRXDYDNUSA-N |
| XLogP | 4.71 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|