C17H33NNaO — CID 172681063
CID 172681063 (PubChem CID 172681063) has the molecular formula C17H33NNaO and a molecular weight of 290.45 g/mol.
| Compound Name | CID 172681063 |
|---|---|
| PubChem CID | 172681063 |
| Molecular Formula | C17H33NNaO |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | — |
| SMILES | C=CC(=O)NC(C)CCCCCCCCCCCC.[Na] |
| InChI | InChI=1S/C17H33NO.Na/c1-4-6-7-8-9-10-11-12-13-14-15-16(3)18-17(19)5-2;/h5,16H,2,4,6-15H2,1,3H3,(H,18,19); |
| InChIKey | AKDIDKKTOBFBIK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|