About sulfane;N-tetradecan-2-ylprop-2-enamide
sulfane;N-tetradecan-2-ylprop-2-enamide (PubChem CID 161423391) has the molecular formula C17H35NOS
and a molecular weight of 301.54 g/mol. Its IUPAC name is sulfane;N-tetradecan-2-ylprop-2-enamide.
Molecular Properties
| Compound Name | sulfane;N-tetradecan-2-ylprop-2-enamide |
| PubChem CID | 161423391 |
| Molecular Formula | C17H35NOS |
| Molecular Weight | 301.54 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | sulfane;N-tetradecan-2-ylprop-2-enamide |
| SMILES | C=CC(=O)NC(C)CCCCCCCCCCCC.S |
| InChI | InChI=1S/C17H33NO.H2S/c1-4-6-7-8-9-10-11-12-13-14-15-16(3)18-17(19)5-2;/h5,16H,2,4,6-15H2,1,3H3,(H,18,19);1H2 |
| InChIKey | RPJZODYORVVVQY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sulfane;N-tetradecan-2-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;N-tetradecan-2-ylprop-2-enamide?
The IUPAC name of sulfane;N-tetradecan-2-ylprop-2-enamide (CID 161423391) is sulfane;N-tetradecan-2-ylprop-2-enamide.
What is the SMILES notation for sulfane;N-tetradecan-2-ylprop-2-enamide?
The canonical SMILES for sulfane;N-tetradecan-2-ylprop-2-enamide is C=CC(=O)NC(C)CCCCCCCCCCCC.S.
What is the InChIKey of sulfane;N-tetradecan-2-ylprop-2-enamide?
The InChIKey is RPJZODYORVVVQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO.H2S/c1-4-6-7-8-9-10-11-12-13-14-15-16(3)18-17(19)5-2;/h5,16H,2,4,6-15H2,1,3H3,(H,18,19);1H2.
What are the key properties of sulfane;N-tetradecan-2-ylprop-2-enamide?
sulfane;N-tetradecan-2-ylprop-2-enamide has a molecular weight of 301.54 g/mol, XLogP of 5.10, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;N-tetradecan-2-ylprop-2-enamide is sourced from PubChem (CID 161423391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).