C18H34N2O2 — CID 87996571
(Z)-N,N'-di(heptan-2-yl)but-2-enediamide (PubChem CID 87996571) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is (Z)-N,N'-di(heptan-2-yl)but-2-enediamide.
| Compound Name | (Z)-N,N'-di(heptan-2-yl)but-2-enediamide |
|---|---|
| PubChem CID | 87996571 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | (Z)-N,N'-di(heptan-2-yl)but-2-enediamide |
| SMILES | CCCCCC(C)NC(=O)/C=C\C(=O)NC(C)CCCCC |
| InChI | InChI=1S/C18H34N2O2/c1-5-7-9-11-15(3)19-17(21)13-14-18(22)20-16(4)12-10-8-6-2/h13-16H,5-12H2,1-4H3,(H,19,21)(H,20,22)/b14-13- |
| InChIKey | QSJAASNCVYHFNA-YPKPFQOOSA-N |
| XLogP | 3.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|