C18H26N2O2 — CID 46571095
(E)-3-(4-acetamidophenyl)-N-heptan-2-ylprop-2-enamide (PubChem CID 46571095) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (E)-3-(4-acetamidophenyl)-N-heptan-2-ylprop-2-enamide.
| Compound Name | (E)-3-(4-acetamidophenyl)-N-heptan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 46571095 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (E)-3-(4-acetamidophenyl)-N-heptan-2-ylprop-2-enamide |
| SMILES | CCCCCC(C)NC(=O)/C=C/c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C18H26N2O2/c1-4-5-6-7-14(2)19-18(22)13-10-16-8-11-17(12-9-16)20-15(3)21/h8-14H,4-7H2,1-3H3,(H,19,22)(H,20,21)/b13-10+ |
| InChIKey | PPPGCQGVDDQCJO-JLHYYAGUSA-N |
| XLogP | 3.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|