C13H23NO — CID 78841357
(2E)-N-heptan-2-ylhexa-2,4-dienamide (PubChem CID 78841357) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2E)-N-heptan-2-ylhexa-2,4-dienamide.
| Compound Name | (2E)-N-heptan-2-ylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 78841357 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2E)-N-heptan-2-ylhexa-2,4-dienamide |
| SMILES | CC=C/C=C/C(=O)NC(C)CCCCC |
| InChI | InChI=1S/C13H23NO/c1-4-6-8-10-12(3)14-13(15)11-9-7-5-2/h5,7,9,11-12H,4,6,8,10H2,1-3H3,(H,14,15)/b7-5?,11-9+ |
| InChIKey | GFVWGQMCRNWJRI-NYCRTDSVSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|