C10H17NO2 — CID 115283586
N-(4-hydroxybutan-2-yl)hexa-2,4-dienamide (PubChem CID 115283586) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-(4-hydroxybutan-2-yl)hexa-2,4-dienamide.
| Compound Name | N-(4-hydroxybutan-2-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 115283586 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-(4-hydroxybutan-2-yl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NC(C)CCO |
| InChI | InChI=1S/C10H17NO2/c1-3-4-5-6-10(13)11-9(2)7-8-12/h3-6,9,12H,7-8H2,1-2H3,(H,11,13) |
| InChIKey | IPWBRIAMSAGSKA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|