C18H36N2O4 — CID 21340416
N,N'-di(heptan-2-yl)-2,3-dihydroxybutanediamide (PubChem CID 21340416) has the molecular formula C18H36N2O4 and a molecular weight of 344.50 g/mol. Its IUPAC name is N,N'-di(heptan-2-yl)-2,3-dihydroxybutanediamide.
| Compound Name | N,N'-di(heptan-2-yl)-2,3-dihydroxybutanediamide |
|---|---|
| PubChem CID | 21340416 |
| Molecular Formula | C18H36N2O4 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | N,N'-di(heptan-2-yl)-2,3-dihydroxybutanediamide |
| SMILES | CCCCCC(C)NC(=O)C(O)C(O)C(=O)NC(C)CCCCC |
| InChI | InChI=1S/C18H36N2O4/c1-5-7-9-11-13(3)19-17(23)15(21)16(22)18(24)20-14(4)12-10-8-6-2/h13-16,21-22H,5-12H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | GQFNPRHBNHXIMS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|