C13H28N2O — CID 61154567
(2S)-2-amino-N-heptan-2-yl-3,3-dimethylbutanamide (PubChem CID 61154567) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is (2S)-2-amino-N-heptan-2-yl-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-heptan-2-yl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 61154567 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | (2S)-2-amino-N-heptan-2-yl-3,3-dimethylbutanamide |
| SMILES | CCCCCC(C)NC(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C13H28N2O/c1-6-7-8-9-10(2)15-12(16)11(14)13(3,4)5/h10-11H,6-9,14H2,1-5H3,(H,15,16)/t10?,11-/m1/s1 |
| InChIKey | KRVYMLXMTVTLDN-RRKGBCIJSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|