C18H36N4S2 — CID 98132831
1-prop-2-enyl-3-[[(2S)-tridecan-2-yl]carbamothioylamino]thiourea (PubChem CID 98132831) has the molecular formula C18H36N4S2 and a molecular weight of 372.65 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[[(2S)-tridecan-2-yl]carbamothioylamino]thiourea.
| Compound Name | 1-prop-2-enyl-3-[[(2S)-tridecan-2-yl]carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 98132831 |
| Molecular Formula | C18H36N4S2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1-prop-2-enyl-3-[[(2S)-tridecan-2-yl]carbamothioylamino]thiourea |
| SMILES | C=CCNC(=S)NNC(=S)N[C@@H](C)CCCCCCCCCCC |
| InChI | InChI=1S/C18H36N4S2/c1-4-6-7-8-9-10-11-12-13-14-16(3)20-18(24)22-21-17(23)19-15-5-2/h5,16H,2,4,6-15H2,1,3H3,(H2,19,21,23)(H2,20,22,24)/t16-/m0/s1 |
| InChIKey | XPDYXQKVBYSDFJ-INIZCTEOSA-N |
| XLogP | 4.32 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|