About trimethylplumbyl 2-ethylhexanoate
trimethylplumbyl 2-ethylhexanoate (PubChem CID 16683317) has the molecular formula C11H24O2Pb
and a molecular weight of 395.51 g/mol. Its IUPAC name is trimethylplumbyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | trimethylplumbyl 2-ethylhexanoate |
| PubChem CID | 16683317 |
| Molecular Formula | C11H24O2Pb |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | trimethylplumbyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)O[Pb](C)(C)C |
| InChI | InChI=1S/C8H16O2.3CH3.Pb/c1-3-5-6-7(4-2)8(9)10;;;;/h7H,3-6H2,1-2H3,(H,9,10);3*1H3;/q;;;;+1/p-1 |
| InChIKey | JXDZOBJJEHJJBV-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trimethylplumbyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylplumbyl 2-ethylhexanoate?
The IUPAC name of trimethylplumbyl 2-ethylhexanoate (CID 16683317) is trimethylplumbyl 2-ethylhexanoate.
What is the SMILES notation for trimethylplumbyl 2-ethylhexanoate?
The canonical SMILES for trimethylplumbyl 2-ethylhexanoate is CCCCC(CC)C(=O)O[Pb](C)(C)C.
What is the InChIKey of trimethylplumbyl 2-ethylhexanoate?
The InChIKey is JXDZOBJJEHJJBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.3CH3.Pb/c1-3-5-6-7(4-2)8(9)10;;;;/h7H,3-6H2,1-2H3,(H,9,10);3*1H3;/q;;;;+1/p-1.
What are the key properties of trimethylplumbyl 2-ethylhexanoate?
trimethylplumbyl 2-ethylhexanoate has a molecular weight of 395.51 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylplumbyl 2-ethylhexanoate is sourced from PubChem (CID 16683317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).